C40H48N6 — CID 145162384
(3Z,7E)-1,6,6-triethyl-7-[9-methyl-7-(2-methylphenyl)-8H-purin-8-yl]-2-(2,4,6-trimethylphenyl)-1,5-dihydro-2,5-benzodiazecine (PubChem CID 145162384) has the molecular formula C40H48N6 and a molecular weight of 612.87 g/mol. Its IUPAC name is (3Z,7E)-1,6,6-triethyl-7-[9-methyl-7-(2-methylphenyl)-8H-purin-8-yl]-2-(2,4,6-trimethylphenyl)-1,5-dihydro-2,5-benzodiazecine.
| Compound Name | (3Z,7E)-1,6,6-triethyl-7-[9-methyl-7-(2-methylphenyl)-8H-purin-8-yl]-2-(2,4,6-trimethylphenyl)-1,5-dihydro-2,5-benzodiazecine |
|---|---|
| PubChem CID | 145162384 |
| Molecular Formula | C40H48N6 |
| Molecular Weight | 612.87 g/mol |
| Exact Mass | 612.39 |
| IUPAC Name | (3Z,7E)-1,6,6-triethyl-7-[9-methyl-7-(2-methylphenyl)-8H-purin-8-yl]-2-(2,4,6-trimethylphenyl)-1,5-dihydro-2,5-benzodiazecine |
| SMILES | CCC1c2ccccc2/C=C(/C2N(C)c3ncncc3N2c2ccccc2C)C(CC)(CC)N/C=C\N1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C40H48N6/c1-9-34-32-18-14-13-17-31(32)24-33(39-44(8)38-36(25-41-26-42-38)46(39)35-19-15-12-16-28(35)5)40(10-2,11-3)43-20-21-45(34)37-29(6)22-27(4)23-30(37)7/h12-26,34,39,43H,9-11H2,1-8H3/b21-20-,33-24- |
| InChIKey | AXNMYYXECPZCME-ZPSGNUPISA-N |
| XLogP | 9.30 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.87 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |