C28H52N6O9S — CID 145163851
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[[2-[[1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-2-oxoethyl]carbamothioylamino]ethoxy]ethoxy]propanoate;ethane;propane (PubChem CID 145163851) has the molecular formula C28H52N6O9S and a molecular weight of 648.82 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[[2-[[1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-2-oxoethyl]carbamothioylamino]ethoxy]ethoxy]propanoate;ethane;propane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[[2-[[1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-2-oxoethyl]carbamothioylamino]ethoxy]ethoxy]propanoate;ethane;propane |
|---|---|
| PubChem CID | 145163851 |
| Molecular Formula | C28H52N6O9S |
| Molecular Weight | 648.82 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[[2-[[1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-2-oxoethyl]carbamothioylamino]ethoxy]ethoxy]propanoate;ethane;propane |
| SMILES | CC.CC(C)C(=O)C(CCCNC(N)=O)NC(=O)CNC(=S)NCCOCCOCCC(=O)ON1C(=O)CCC1=O.CCC |
| InChI | InChI=1S/C23H38N6O9S.C3H8.C2H6/c1-15(2)21(34)16(4-3-8-25-22(24)35)28-17(30)14-27-23(39)26-9-11-37-13-12-36-10-7-20(33)38-29-18(31)5-6-19(29)32;1-3-2;1-2/h15-16H,3-14H2,1-2H3,(H,28,30)(H3,24,25,35)(H2,26,27,39);3H2,1-2H3;1-2H3 |
| InChIKey | BETPDDBCAIQYCR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 207.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.82 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|