C23H25F2N3O5 — CID 145166354
N-[(2,4-difluoro-3-methylphenyl)methyl]-4-hydroxy-2,5-dioxo-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6,12-triene-6-carboxamide;methoxymethane (PubChem CID 145166354) has the molecular formula C23H25F2N3O5 and a molecular weight of 461.47 g/mol. Its IUPAC name is N-[(2,4-difluoro-3-methylphenyl)methyl]-4-hydroxy-2,5-dioxo-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6,12-triene-6-carboxamide;methoxymethane.
| Compound Name | N-[(2,4-difluoro-3-methylphenyl)methyl]-4-hydroxy-2,5-dioxo-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6,12-triene-6-carboxamide;methoxymethane |
|---|---|
| PubChem CID | 145166354 |
| Molecular Formula | C23H25F2N3O5 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-[(2,4-difluoro-3-methylphenyl)methyl]-4-hydroxy-2,5-dioxo-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6,12-triene-6-carboxamide;methoxymethane |
| SMILES | COC.Cc1c(F)ccc(CNC(=O)c2cn3c(c(O)c2=O)C(=O)N2CC=CCC2C3)c1F |
| InChI | InChI=1S/C21H19F2N3O4.C2H6O/c1-11-15(22)6-5-12(16(11)23)8-24-20(29)14-10-25-9-13-4-2-3-7-26(13)21(30)17(25)19(28)18(14)27;1-3-2/h2-3,5-6,10,13,28H,4,7-9H2,1H3,(H,24,29);1-2H3 |
| InChIKey | OVHNCXZYCXLHRJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|