C13H11F4NO4 — CID 145166626
3,5-difluoro-4-nitrophenol;3,5-difluorophenol;methane (PubChem CID 145166626) has the molecular formula C13H11F4NO4 and a molecular weight of 321.23 g/mol. Its IUPAC name is 3,5-difluoro-4-nitrophenol;3,5-difluorophenol;methane.
| Compound Name | 3,5-difluoro-4-nitrophenol;3,5-difluorophenol;methane |
|---|---|
| PubChem CID | 145166626 |
| Molecular Formula | C13H11F4NO4 |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3,5-difluoro-4-nitrophenol;3,5-difluorophenol;methane |
| SMILES | C.O=[N+]([O-])c1c(F)cc(O)cc1F.Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C6H3F2NO3.C6H4F2O.CH4/c7-4-1-3(10)2-5(8)6(4)9(11)12;7-4-1-5(8)3-6(9)2-4;/h1-2,10H;1-3,9H;1H4 |
| InChIKey | BLFBJGOCTLTOOF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|