C14H20ClN5O4 — CID 145168958
(2S)-2,6-diamino-7-[(4-azidophenyl)methoxy]-7-oxoheptanoic acid;hydrochloride (PubChem CID 145168958) has the molecular formula C14H20ClN5O4 and a molecular weight of 357.80 g/mol. Its IUPAC name is (2S)-2,6-diamino-7-[(4-azidophenyl)methoxy]-7-oxoheptanoic acid;hydrochloride.
| Compound Name | (2S)-2,6-diamino-7-[(4-azidophenyl)methoxy]-7-oxoheptanoic acid;hydrochloride |
|---|---|
| PubChem CID | 145168958 |
| Molecular Formula | C14H20ClN5O4 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (2S)-2,6-diamino-7-[(4-azidophenyl)methoxy]-7-oxoheptanoic acid;hydrochloride |
| SMILES | Cl.[N-]=[N+]=Nc1ccc(COC(=O)C(N)CCC[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C14H19N5O4.ClH/c15-11(13(20)21)2-1-3-12(16)14(22)23-8-9-4-6-10(7-5-9)18-19-17;/h4-7,11-12H,1-3,8,15-16H2,(H,20,21);1H/t11-,12?;/m0./s1 |
| InChIKey | MTZUGQPYIIJOBI-YLIVSKOQSA-N |
| XLogP | 2.00 |
| TPSA | 164.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|