C16H20 — CID 145170282
3-(3-ethylcyclopenta-1,4-dien-1-yl)propylbenzene (PubChem CID 145170282) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is 3-(3-ethylcyclopenta-1,4-dien-1-yl)propylbenzene.
| Compound Name | 3-(3-ethylcyclopenta-1,4-dien-1-yl)propylbenzene |
|---|---|
| PubChem CID | 145170282 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 3-(3-ethylcyclopenta-1,4-dien-1-yl)propylbenzene |
| SMILES | CCC1C=CC(CCCc2ccccc2)=C1 |
| InChI | InChI=1S/C16H20/c1-2-14-11-12-16(13-14)10-6-9-15-7-4-3-5-8-15/h3-5,7-8,11-14H,2,6,9-10H2,1H3 |
| InChIKey | PGRPLOHOSOTMNB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |