C23H18F6N6OS — CID 145171413
4-[[2-[4-[4-(trifluoromethoxy)phenyl]sulfanylpiperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 145171413) has the molecular formula C23H18F6N6OS and a molecular weight of 540.49 g/mol. Its IUPAC name is 4-[[2-[4-[4-(trifluoromethoxy)phenyl]sulfanylpiperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 4-[[2-[4-[4-(trifluoromethoxy)phenyl]sulfanylpiperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 145171413 |
| Molecular Formula | C23H18F6N6OS |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 4-[[2-[4-[4-(trifluoromethoxy)phenyl]sulfanylpiperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2cc(C(F)(F)F)nc(N3CCN(Sc4ccc(OC(F)(F)F)cc4)CC3)n2)cc1 |
| InChI | InChI=1S/C23H18F6N6OS/c24-22(25,26)19-13-20(31-16-3-1-15(14-30)2-4-16)33-21(32-19)34-9-11-35(12-10-34)37-18-7-5-17(6-8-18)36-23(27,28)29/h1-8,13H,9-12H2,(H,31,32,33) |
| InChIKey | QDPUILAMYSZSRQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 77.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|