C22H23N3 — CID 145172535
7-(1-phenylpiperidin-4-yl)-4,6-diazatricyclo[6.5.0.02,6]trideca-1(8),2,4,9,12-pentaene (PubChem CID 145172535) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is 7-(1-phenylpiperidin-4-yl)-4,6-diazatricyclo[6.5.0.02,6]trideca-1(8),2,4,9,12-pentaene.
| Compound Name | 7-(1-phenylpiperidin-4-yl)-4,6-diazatricyclo[6.5.0.02,6]trideca-1(8),2,4,9,12-pentaene |
|---|---|
| PubChem CID | 145172535 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 7-(1-phenylpiperidin-4-yl)-4,6-diazatricyclo[6.5.0.02,6]trideca-1(8),2,4,9,12-pentaene |
| SMILES | C1=CC2=C(C=CC1)C(C1CCN(c3ccccc3)CC1)n1cncc12 |
| InChI | InChI=1S/C22H23N3/c1-3-7-18(8-4-1)24-13-11-17(12-14-24)22-20-10-6-2-5-9-19(20)21-15-23-16-25(21)22/h1,3-10,15-17,22H,2,11-14H2 |
| InChIKey | SQBLJXSBOFKNGE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |