C13H13FO4 — CID 145173448
(4aR,8S,8aR)-8-fluoro-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-one (PubChem CID 145173448) has the molecular formula C13H13FO4 and a molecular weight of 252.24 g/mol. Its IUPAC name is (4aR,8S,8aR)-8-fluoro-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-one.
| Compound Name | (4aR,8S,8aR)-8-fluoro-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-one |
|---|---|
| PubChem CID | 145173448 |
| Molecular Formula | C13H13FO4 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (4aR,8S,8aR)-8-fluoro-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-one |
| SMILES | O=C1CO[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]1F |
| InChI | InChI=1S/C13H13FO4/c14-11-9(15)6-16-10-7-17-13(18-12(10)11)8-4-2-1-3-5-8/h1-5,10-13H,6-7H2/t10-,11-,12-,13?/m1/s1 |
| InChIKey | JNGBSFZZKHUAKY-PFGBXZAXSA-N |
| XLogP | 1.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |