C16H14N6O2 — CID 145176609
N-[5-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]-1H-pyrazol-4-yl]-5-(1H-pyrazol-4-yl)furan-2-carboxamide (PubChem CID 145176609) has the molecular formula C16H14N6O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is N-[5-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]-1H-pyrazol-4-yl]-5-(1H-pyrazol-4-yl)furan-2-carboxamide.
| Compound Name | N-[5-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]-1H-pyrazol-4-yl]-5-(1H-pyrazol-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 145176609 |
| Molecular Formula | C16H14N6O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-[5-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]-1H-pyrazol-4-yl]-5-(1H-pyrazol-4-yl)furan-2-carboxamide |
| SMILES | C=C/C=C(\N=C)c1[nH]ncc1NC(=O)c1ccc(-c2cn[nH]c2)o1 |
| InChI | InChI=1S/C16H14N6O2/c1-3-4-11(17-2)15-12(9-20-22-15)21-16(23)14-6-5-13(24-14)10-7-18-19-8-10/h3-9H,1-2H2,(H,18,19)(H,20,22)(H,21,23)/b11-4- |
| InChIKey | OCGDGILVZLRNJA-WCIBSUBMSA-N |
| XLogP | 2.87 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|