C41H37N5O3 — CID 145182859
3-[[(2E)-2-(cyclopropylmethylidene)but-3-ynoyl]amino]-N-[1-[[4-(5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl)phenyl]methyl]piperidin-4-yl]benzamide (PubChem CID 145182859) has the molecular formula C41H37N5O3 and a molecular weight of 647.78 g/mol. Its IUPAC name is 3-[[(2E)-2-(cyclopropylmethylidene)but-3-ynoyl]amino]-N-[1-[[4-(5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl)phenyl]methyl]piperidin-4-yl]benzamide.
| Compound Name | 3-[[(2E)-2-(cyclopropylmethylidene)but-3-ynoyl]amino]-N-[1-[[4-(5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl)phenyl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 145182859 |
| Molecular Formula | C41H37N5O3 |
| Molecular Weight | 647.78 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | 3-[[(2E)-2-(cyclopropylmethylidene)but-3-ynoyl]amino]-N-[1-[[4-(5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl)phenyl]methyl]piperidin-4-yl]benzamide |
| SMILES | C#C/C(=C\C1CC1)C(=O)Nc1cccc(C(=O)NC2CCN(Cc3ccc(-c4nc5cc[nH]c(=O)c5cc4-c4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C41H37N5O3/c1-2-29(23-27-11-12-27)39(47)44-34-10-6-9-32(24-34)40(48)43-33-18-21-46(22-19-33)26-28-13-15-31(16-14-28)38-35(30-7-4-3-5-8-30)25-36-37(45-38)17-20-42-41(36)49/h1,3-10,13-17,20,23-25,27,33H,11-12,18-19,21-22,26H2,(H,42,49)(H,43,48)(H,44,47)/b29-23+ |
| InChIKey | WCHRCOFOMWSJEA-BYNJWEBRSA-N |
| XLogP | 6.56 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.78 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|