C12H20S — CID 145186058
2-(1,2,3,4,4a,5,8,8a-octahydronaphthalen-2-yl)ethanethiol (PubChem CID 145186058) has the molecular formula C12H20S and a molecular weight of 196.36 g/mol. Its IUPAC name is 2-(1,2,3,4,4a,5,8,8a-octahydronaphthalen-2-yl)ethanethiol.
| Compound Name | 2-(1,2,3,4,4a,5,8,8a-octahydronaphthalen-2-yl)ethanethiol |
|---|---|
| PubChem CID | 145186058 |
| Molecular Formula | C12H20S |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-(1,2,3,4,4a,5,8,8a-octahydronaphthalen-2-yl)ethanethiol |
| SMILES | SCCC1CCC2CC=CCC2C1 |
| InChI | InChI=1S/C12H20S/c13-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-2,10-13H,3-9H2 |
| InChIKey | VIKIRJKBVOUYJJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|