C15H20F6 — CID 20759709
2-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]-1,2,3,4,4a,5,8,8a-octahydronaphthalene (PubChem CID 20759709) has the molecular formula C15H20F6 and a molecular weight of 314.31 g/mol. Its IUPAC name is 2-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]-1,2,3,4,4a,5,8,8a-octahydronaphthalene.
| Compound Name | 2-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]-1,2,3,4,4a,5,8,8a-octahydronaphthalene |
|---|---|
| PubChem CID | 20759709 |
| Molecular Formula | C15H20F6 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]-1,2,3,4,4a,5,8,8a-octahydronaphthalene |
| SMILES | CC(CC1CCC2CC=CCC2C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H20F6/c1-13(14(16,17)18,15(19,20)21)9-10-6-7-11-4-2-3-5-12(11)8-10/h2-3,10-12H,4-9H2,1H3 |
| InChIKey | UAMQHVINJQFMQG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|