C30H49N5O6 — CID 145187165
6-formamido-N-[(E)-2-methylhex-4-en-3-yl]hexanamide;methyl 2-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamoylamino]-3-methylbutanoate (PubChem CID 145187165) has the molecular formula C30H49N5O6 and a molecular weight of 575.75 g/mol. Its IUPAC name is 6-formamido-N-[(E)-2-methylhex-4-en-3-yl]hexanamide;methyl 2-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamoylamino]-3-methylbutanoate.
| Compound Name | 6-formamido-N-[(E)-2-methylhex-4-en-3-yl]hexanamide;methyl 2-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 145187165 |
| Molecular Formula | C30H49N5O6 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.37 |
| IUPAC Name | 6-formamido-N-[(E)-2-methylhex-4-en-3-yl]hexanamide;methyl 2-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamoylamino]-3-methylbutanoate |
| SMILES | C/C=C/C(NC(=O)CCCCCNC=O)C(C)C.COC(=O)C(NC(=O)N[C@@H](Cc1ccccc1)C(N)=O)C(C)C |
| InChI | InChI=1S/C16H23N3O4.C14H26N2O2/c1-10(2)13(15(21)23-3)19-16(22)18-12(14(17)20)9-11-7-5-4-6-8-11;1-4-8-13(12(2)3)16-14(18)9-6-5-7-10-15-11-17/h4-8,10,12-13H,9H2,1-3H3,(H2,17,20)(H2,18,19,22);4,8,11-13H,5-7,9-10H2,1-3H3,(H,15,17)(H,16,18)/b;8-4+/t12-,13?;/m0./s1 |
| InChIKey | OJNKOZSFWPHMOL-RXLSXQJNSA-N |
| XLogP | 2.59 |
| TPSA | 168.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|