About 5-N-propan-2-yl-3,4-dihydro-2H-thiopyran-5,6-diamine
5-N-propan-2-yl-3,4-dihydro-2H-thiopyran-5,6-diamine (PubChem CID 145188275) has the molecular formula C8H16N2S
and a molecular weight of 172.30 g/mol. Its IUPAC name is 5-N-propan-2-yl-3,4-dihydro-2H-thiopyran-5,6-diamine.
Analyze 5-N-propan-2-yl-3,4-dihydro-2H-thiopyran-5,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-propan-2-yl-3,4-dihydro-2H-thiopyran-5,6-diamine?
The IUPAC name of 5-N-propan-2-yl-3,4-dihydro-2H-thiopyran-5,6-diamine (CID 145188275) is 5-N-propan-2-yl-3,4-dihydro-2H-thiopyran-5,6-diamine.
What is the SMILES notation for 5-N-propan-2-yl-3,4-dihydro-2H-thiopyran-5,6-diamine?
The canonical SMILES for 5-N-propan-2-yl-3,4-dihydro-2H-thiopyran-5,6-diamine is CC(C)NC1=C(N)SCCC1.
What is the InChIKey of 5-N-propan-2-yl-3,4-dihydro-2H-thiopyran-5,6-diamine?
The InChIKey is PNBTXPNEFMNKSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S/c1-6(2)10-7-4-3-5-11-8(7)9/h6,10H,3-5,9H2,1-2H3.
What are the key properties of 5-N-propan-2-yl-3,4-dihydro-2H-thiopyran-5,6-diamine?
5-N-propan-2-yl-3,4-dihydro-2H-thiopyran-5,6-diamine has a molecular weight of 172.30 g/mol, XLogP of 1.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-propan-2-yl-3,4-dihydro-2H-thiopyran-5,6-diamine is sourced from PubChem (CID 145188275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).