C15H11Cl2IN3O4P — CID 145192708
6-(2,6-dichloro-3,5-dimethoxyphenyl)-1-iodophosphanylpyrazolo[5,4-b]pyridine-3-carboxylic acid (PubChem CID 145192708) has the molecular formula C15H11Cl2IN3O4P and a molecular weight of 526.05 g/mol. Its IUPAC name is 6-(2,6-dichloro-3,5-dimethoxyphenyl)-1-iodophosphanylpyrazolo[5,4-b]pyridine-3-carboxylic acid.
| Compound Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-1-iodophosphanylpyrazolo[5,4-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 145192708 |
| Molecular Formula | C15H11Cl2IN3O4P |
| Molecular Weight | 526.05 g/mol |
| Exact Mass | 524.89 |
| IUPAC Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-1-iodophosphanylpyrazolo[5,4-b]pyridine-3-carboxylic acid |
| SMILES | COc1cc(OC)c(Cl)c(-c2ccc3c(C(=O)O)nn(PI)c3n2)c1Cl |
| InChI | InChI=1S/C15H11Cl2IN3O4P/c1-24-8-5-9(25-2)12(17)10(11(8)16)7-4-3-6-13(15(22)23)20-21(26-18)14(6)19-7/h3-5,26H,1-2H3,(H,22,23) |
| InChIKey | QOMLDUVSIGRZKL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.05 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|