C7H4ClIN3O2P — CID 171067304
6-chloro-1-iodophosphanylpyrazolo[5,4-b]pyridine-4-carboxylic acid (PubChem CID 171067304) has the molecular formula C7H4ClIN3O2P and a molecular weight of 355.46 g/mol. Its IUPAC name is 6-chloro-1-iodophosphanylpyrazolo[5,4-b]pyridine-4-carboxylic acid.
| Compound Name | 6-chloro-1-iodophosphanylpyrazolo[5,4-b]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 171067304 |
| Molecular Formula | C7H4ClIN3O2P |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 354.88 |
| IUPAC Name | 6-chloro-1-iodophosphanylpyrazolo[5,4-b]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)nc2c1cnn2PI |
| InChI | InChI=1S/C7H4ClIN3O2P/c8-5-1-3(7(13)14)4-2-10-12(15-9)6(4)11-5/h1-2,15H,(H,13,14) |
| InChIKey | NWWPSCPYJLUZPB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|