C11H12N2O6 — CID 145202618
3-(2,5-dioxopyrrol-1-yl)propanoic acid;pyrrolidine-2,5-dione (PubChem CID 145202618) has the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)propanoic acid;pyrrolidine-2,5-dione.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)propanoic acid;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 145202618 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)propanoic acid;pyrrolidine-2,5-dione |
| SMILES | O=C(O)CCN1C(=O)C=CC1=O.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C7H7NO4.C4H5NO2/c9-5-1-2-6(10)8(5)4-3-7(11)12;6-3-1-2-4(7)5-3/h1-2H,3-4H2,(H,11,12);1-2H2,(H,5,6,7) |
| InChIKey | JNFQQUCKEPNIDP-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|