C10H11N3O6 — CID 91185335
amino 2-(2,5-dioxopyrrol-1-yl)acetate;pyrrolidine-2,5-dione (PubChem CID 91185335) has the molecular formula C10H11N3O6 and a molecular weight of 269.21 g/mol. Its IUPAC name is amino 2-(2,5-dioxopyrrol-1-yl)acetate;pyrrolidine-2,5-dione.
| Compound Name | amino 2-(2,5-dioxopyrrol-1-yl)acetate;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 91185335 |
| Molecular Formula | C10H11N3O6 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | amino 2-(2,5-dioxopyrrol-1-yl)acetate;pyrrolidine-2,5-dione |
| SMILES | NOC(=O)CN1C(=O)C=CC1=O.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C6H6N2O4.C4H5NO2/c7-12-6(11)3-8-4(9)1-2-5(8)10;6-3-1-2-4(7)5-3/h1-2H,3,7H2;1-2H2,(H,5,6,7) |
| InChIKey | GCAQLSMYGUCLAP-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|