C13H20N2 — CID 145203726
4-butyl-2-methanimidoyl-N,6-dimethylaniline (PubChem CID 145203726) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 4-butyl-2-methanimidoyl-N,6-dimethylaniline.
| Compound Name | 4-butyl-2-methanimidoyl-N,6-dimethylaniline |
|---|---|
| PubChem CID | 145203726 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 4-butyl-2-methanimidoyl-N,6-dimethylaniline |
| SMILES | [H]/N=C/c1cc(CCCC)cc(C)c1NC |
| InChI | InChI=1S/C13H20N2/c1-4-5-6-11-7-10(2)13(15-3)12(8-11)9-14/h7-9,14-15H,4-6H2,1-3H3/b14-9+ |
| InChIKey | LHOITJSLPBRISV-NTEUORMPSA-N |
| XLogP | 3.38 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|