C27H33Cl2F2N2O3P — CID 145206419
N-[4-[[2,4-dichloro-3-[[6-[difluoro(phosphanyl)methyl]-1,4-dimethylindol-2-yl]methyl]phenyl]methyl]-5-oxopentyl]formamide;methoxymethane (PubChem CID 145206419) has the molecular formula C27H33Cl2F2N2O3P and a molecular weight of 573.45 g/mol. Its IUPAC name is N-[4-[[2,4-dichloro-3-[[6-[difluoro(phosphanyl)methyl]-1,4-dimethylindol-2-yl]methyl]phenyl]methyl]-5-oxopentyl]formamide;methoxymethane.
| Compound Name | N-[4-[[2,4-dichloro-3-[[6-[difluoro(phosphanyl)methyl]-1,4-dimethylindol-2-yl]methyl]phenyl]methyl]-5-oxopentyl]formamide;methoxymethane |
|---|---|
| PubChem CID | 145206419 |
| Molecular Formula | C27H33Cl2F2N2O3P |
| Molecular Weight | 573.45 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | N-[4-[[2,4-dichloro-3-[[6-[difluoro(phosphanyl)methyl]-1,4-dimethylindol-2-yl]methyl]phenyl]methyl]-5-oxopentyl]formamide;methoxymethane |
| SMILES | COC.Cc1cc(C(F)(F)P)cc2c1cc(Cc1c(Cl)ccc(CC(C=O)CCCNC=O)c1Cl)n2C |
| InChI | InChI=1S/C25H27Cl2F2N2O2P.C2H6O/c1-15-8-18(25(28,29)34)10-23-20(15)11-19(31(23)2)12-21-22(26)6-5-17(24(21)27)9-16(13-32)4-3-7-30-14-33;1-3-2/h5-6,8,10-11,13-14,16H,3-4,7,9,12,34H2,1-2H3,(H,30,33);1-2H3 |
| InChIKey | KCKAZBXNEVJZMM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.45 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|