C23H27N3O4S — CID 145209399
5-[(2-methoxyphenyl)sulfanylamino]-7-(morpholin-3-ylmethoxy)spiro[1H-indole-3,1'-cyclobutane]-2-one (PubChem CID 145209399) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 5-[(2-methoxyphenyl)sulfanylamino]-7-(morpholin-3-ylmethoxy)spiro[1H-indole-3,1'-cyclobutane]-2-one.
| Compound Name | 5-[(2-methoxyphenyl)sulfanylamino]-7-(morpholin-3-ylmethoxy)spiro[1H-indole-3,1'-cyclobutane]-2-one |
|---|---|
| PubChem CID | 145209399 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 5-[(2-methoxyphenyl)sulfanylamino]-7-(morpholin-3-ylmethoxy)spiro[1H-indole-3,1'-cyclobutane]-2-one |
| SMILES | COc1ccccc1SNc1cc(OCC2COCCN2)c2c(c1)C1(CCC1)C(=O)N2 |
| InChI | InChI=1S/C23H27N3O4S/c1-28-18-5-2-3-6-20(18)31-26-15-11-17-21(25-22(27)23(17)7-4-8-23)19(12-15)30-14-16-13-29-10-9-24-16/h2-3,5-6,11-12,16,24,26H,4,7-10,13-14H2,1H3,(H,25,27) |
| InChIKey | FJCAPOUOCYQKRP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|