C29H31ClFN5O2S2 — CID 145211070
[5-amino-1-(2-fluoro-6-methyl-4-phenoxyphenyl)pyrazol-4-yl]-[6-chloro-5-(methylsulfanylamino)-1H-indol-2-yl]methanone;ethane;methanethiol (PubChem CID 145211070) has the molecular formula C29H31ClFN5O2S2 and a molecular weight of 600.19 g/mol. Its IUPAC name is [5-amino-1-(2-fluoro-6-methyl-4-phenoxyphenyl)pyrazol-4-yl]-[6-chloro-5-(methylsulfanylamino)-1H-indol-2-yl]methanone;ethane;methanethiol.
| Compound Name | [5-amino-1-(2-fluoro-6-methyl-4-phenoxyphenyl)pyrazol-4-yl]-[6-chloro-5-(methylsulfanylamino)-1H-indol-2-yl]methanone;ethane;methanethiol |
|---|---|
| PubChem CID | 145211070 |
| Molecular Formula | C29H31ClFN5O2S2 |
| Molecular Weight | 600.19 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | [5-amino-1-(2-fluoro-6-methyl-4-phenoxyphenyl)pyrazol-4-yl]-[6-chloro-5-(methylsulfanylamino)-1H-indol-2-yl]methanone;ethane;methanethiol |
| SMILES | CC.CS.CSNc1cc2cc(C(=O)c3cnn(-c4c(C)cc(Oc5ccccc5)cc4F)c3N)[nH]c2cc1Cl |
| InChI | InChI=1S/C26H21ClFN5O2S.C2H6.CH4S/c1-14-8-17(35-16-6-4-3-5-7-16)11-20(28)24(14)33-26(29)18(13-30-33)25(34)23-10-15-9-22(32-36-2)19(27)12-21(15)31-23;2*1-2/h3-13,31-32H,29H2,1-2H3;1-2H3;2H,1H3 |
| InChIKey | RLPKBLORNIDORG-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.19 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|