C19H35N3O5S — CID 145216074
(4S)-5-[2-(3-methylbutanoylamino)ethylamino]-4-[3-(2-methylpropylsulfanyl)propanoylamino]-5-oxopentanoic acid (PubChem CID 145216074) has the molecular formula C19H35N3O5S and a molecular weight of 417.57 g/mol. Its IUPAC name is (4S)-5-[2-(3-methylbutanoylamino)ethylamino]-4-[3-(2-methylpropylsulfanyl)propanoylamino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-[2-(3-methylbutanoylamino)ethylamino]-4-[3-(2-methylpropylsulfanyl)propanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 145216074 |
| Molecular Formula | C19H35N3O5S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (4S)-5-[2-(3-methylbutanoylamino)ethylamino]-4-[3-(2-methylpropylsulfanyl)propanoylamino]-5-oxopentanoic acid |
| SMILES | CC(C)CSCCC(=O)N[C@@H](CCC(=O)O)C(=O)NCCNC(=O)CC(C)C |
| InChI | InChI=1S/C19H35N3O5S/c1-13(2)11-17(24)20-8-9-21-19(27)15(5-6-18(25)26)22-16(23)7-10-28-12-14(3)4/h13-15H,5-12H2,1-4H3,(H,20,24)(H,21,27)(H,22,23)(H,25,26)/t15-/m0/s1 |
| InChIKey | JPXCMKUTZXKVEW-HNNXBMFYSA-N |
| XLogP | 1.39 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|