C34H35N — CID 145218139
ethane;2-[3-[4-methyl-3-[(4Z)-2-methylhexa-2,4-dien-3-yl]phenyl]phenyl]-9H-carbazole (PubChem CID 145218139) has the molecular formula C34H35N and a molecular weight of 457.66 g/mol. Its IUPAC name is ethane;2-[3-[4-methyl-3-[(4Z)-2-methylhexa-2,4-dien-3-yl]phenyl]phenyl]-9H-carbazole.
| Compound Name | ethane;2-[3-[4-methyl-3-[(4Z)-2-methylhexa-2,4-dien-3-yl]phenyl]phenyl]-9H-carbazole |
|---|---|
| PubChem CID | 145218139 |
| Molecular Formula | C34H35N |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | ethane;2-[3-[4-methyl-3-[(4Z)-2-methylhexa-2,4-dien-3-yl]phenyl]phenyl]-9H-carbazole |
| SMILES | C/C=C\C(=C(C)C)c1cc(-c2cccc(-c3ccc4c(c3)[nH]c3ccccc34)c2)ccc1C.CC |
| InChI | InChI=1S/C32H29N.C2H6/c1-5-9-27(21(2)3)30-19-25(15-14-22(30)4)23-10-8-11-24(18-23)26-16-17-29-28-12-6-7-13-31(28)33-32(29)20-26;1-2/h5-20,33H,1-4H3;1-2H3/b9-5-; |
| InChIKey | VNKHDXNEVKMFFS-UYTGOYFPSA-N |
| XLogP | 10.36 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|