C10H13ClN2 — CID 145222637
3-chloro-6-methylpyrrolo[1,2-a]pyrimidine;ethane (PubChem CID 145222637) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is 3-chloro-6-methylpyrrolo[1,2-a]pyrimidine;ethane.
| Compound Name | 3-chloro-6-methylpyrrolo[1,2-a]pyrimidine;ethane |
|---|---|
| PubChem CID | 145222637 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 3-chloro-6-methylpyrrolo[1,2-a]pyrimidine;ethane |
| SMILES | CC.Cc1ccc2ncc(Cl)cn12 |
| InChI | InChI=1S/C8H7ClN2.C2H6/c1-6-2-3-8-10-4-7(9)5-11(6)8;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | WEWCCIQDTQSJEY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |