C13H15FN2O2 — CID 145222798
(2R,5R)-2-fluoro-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 145222798) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is (2R,5R)-2-fluoro-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (2R,5R)-2-fluoro-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 145222798 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (2R,5R)-2-fluoro-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | C1C[C@H](N2C[C@@H]1N(C2=O)OCC3=CC=CC=C3)F |
| InChI | InChI=1S/C13H15FN2O2/c14-12-7-6-11-8-15(12)13(17)16(11)18-9-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2/t11-,12+/m1/s1 |
| InChIKey | SSNWFBAKXYTWKJ-NEPJUHHUSA-N |
| XLogP | 2.10 |
| TPSA | 32.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | 320 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|