C17H21F2NO2 — CID 145225538
ethane;methyl 1-[(3,4-difluorophenyl)methyl]-3-methylidene-2,4-dihydropyridine-5-carboxylate (PubChem CID 145225538) has the molecular formula C17H21F2NO2 and a molecular weight of 309.36 g/mol. Its IUPAC name is ethane;methyl 1-[(3,4-difluorophenyl)methyl]-3-methylidene-2,4-dihydropyridine-5-carboxylate.
| Compound Name | ethane;methyl 1-[(3,4-difluorophenyl)methyl]-3-methylidene-2,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 145225538 |
| Molecular Formula | C17H21F2NO2 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | ethane;methyl 1-[(3,4-difluorophenyl)methyl]-3-methylidene-2,4-dihydropyridine-5-carboxylate |
| SMILES | C=C1CC(C(=O)OC)=CN(Cc2ccc(F)c(F)c2)C1.CC |
| InChI | InChI=1S/C15H15F2NO2.C2H6/c1-10-5-12(15(19)20-2)9-18(7-10)8-11-3-4-13(16)14(17)6-11;1-2/h3-4,6,9H,1,5,7-8H2,2H3;1-2H3 |
| InChIKey | KJVGZEMXBOEYET-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|