C26H30FN3O2 — CID 145226572
1,1-dimethylcyclohexane;2-[(5-fluoro-2-methyl-1H-indol-3-yl)methyl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 145226572) has the molecular formula C26H30FN3O2 and a molecular weight of 435.54 g/mol. Its IUPAC name is 1,1-dimethylcyclohexane;2-[(5-fluoro-2-methyl-1H-indol-3-yl)methyl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 1,1-dimethylcyclohexane;2-[(5-fluoro-2-methyl-1H-indol-3-yl)methyl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 145226572 |
| Molecular Formula | C26H30FN3O2 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1,1-dimethylcyclohexane;2-[(5-fluoro-2-methyl-1H-indol-3-yl)methyl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | CC1(C)CCCCC1.Cc1[nH]c2ccc(F)cc2c1Cc1nc2ccc(C(=O)O)cc2[nH]1 |
| InChI | InChI=1S/C18H14FN3O2.C8H16/c1-9-12(13-7-11(19)3-5-14(13)20-9)8-17-21-15-4-2-10(18(23)24)6-16(15)22-17;1-8(2)6-4-3-5-7-8/h2-7,20H,8H2,1H3,(H,21,22)(H,23,24);3-7H2,1-2H3 |
| InChIKey | NLMNMBWWFYLTOA-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|