2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid

C13H12N2O3 — CID 145226804

IUPAC2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid
SMILESO=C(O)Cc1c2n(c3ncccc13)CC(=O)CC2
InChIInChI=1S/C13H12N2O3/c16-8-3-4-11-10(6-12(17)18)9-2-1-5-14-13(9)15(11)7-8/h1-2,5H,3-4,6-7H2,(H,17,18)
InChIKeyIPTMAUDONMNIQE-UHFFFAOYSA-N
MW244.25 g/mol
LogP1.18
Rot. Bonds2

About 2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid

2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid (PubChem CID 145226804) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid.

Molecular Properties

Compound Name2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid
PubChem CID145226804
Molecular FormulaC13H12N2O3
Molecular Weight244.25 g/mol
Exact Mass244.08
IUPAC Name2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid
SMILESO=C(O)Cc1c2n(c3ncccc13)CC(=O)CC2
InChIInChI=1S/C13H12N2O3/c16-8-3-4-11-10(6-12(17)18)9-2-1-5-14-13(9)15(11)7-8/h1-2,5H,3-4,6-7H2,(H,17,18)
InChIKeyIPTMAUDONMNIQE-UHFFFAOYSA-N
XLogP1.18
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.25
LogP ≤ 51.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid?
The IUPAC name of 2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid (CID 145226804) is 2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid.
What is the SMILES notation for 2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid?
The canonical SMILES for 2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid is O=C(O)Cc1c2n(c3ncccc13)CC(=O)CC2.
What is the InChIKey of 2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid?
The InChIKey is IPTMAUDONMNIQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3/c16-8-3-4-11-10(6-12(17)18)9-2-1-5-14-13(9)15(11)7-8/h1-2,5H,3-4,6-7H2,(H,17,18).
What are the key properties of 2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid?
2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid has a molecular weight of 244.25 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-oxo-7,9-dihydro-6H-pyrido[3,2-b]indolizin-5-yl)acetic acid is sourced from PubChem (CID 145226804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).