C28H27N3O2 — CID 88928314
N-methyl-N-[(8R)-5-(2-oxoethyl)-6,7,8,9-tetrahydropyrido[3,2-b]indolizin-8-yl]-2,2-diphenylacetamide (PubChem CID 88928314) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-methyl-N-[(8R)-5-(2-oxoethyl)-6,7,8,9-tetrahydropyrido[3,2-b]indolizin-8-yl]-2,2-diphenylacetamide.
| Compound Name | N-methyl-N-[(8R)-5-(2-oxoethyl)-6,7,8,9-tetrahydropyrido[3,2-b]indolizin-8-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 88928314 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-methyl-N-[(8R)-5-(2-oxoethyl)-6,7,8,9-tetrahydropyrido[3,2-b]indolizin-8-yl]-2,2-diphenylacetamide |
| SMILES | CN(C(=O)C(c1ccccc1)c1ccccc1)[C@@H]1CCc2c(CC=O)c3cccnc3n2C1 |
| InChI | InChI=1S/C28H27N3O2/c1-30(28(33)26(20-9-4-2-5-10-20)21-11-6-3-7-12-21)22-14-15-25-23(16-18-32)24-13-8-17-29-27(24)31(25)19-22/h2-13,17-18,22,26H,14-16,19H2,1H3/t22-/m1/s1 |
| InChIKey | CGNXDZOBZSRTBU-JOCHJYFZSA-N |
| XLogP | 4.38 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|