C14H27N3 — CID 145230158
1-N-[2-(methylamino)ethyl]-1-N'-[(Z)-2-methyl-4-methylidenehept-5-en-2-yl]ethene-1,1-diamine (PubChem CID 145230158) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-N-[2-(methylamino)ethyl]-1-N'-[(Z)-2-methyl-4-methylidenehept-5-en-2-yl]ethene-1,1-diamine.
| Compound Name | 1-N-[2-(methylamino)ethyl]-1-N'-[(Z)-2-methyl-4-methylidenehept-5-en-2-yl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 145230158 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 1-N-[2-(methylamino)ethyl]-1-N'-[(Z)-2-methyl-4-methylidenehept-5-en-2-yl]ethene-1,1-diamine |
| SMILES | C=C(/C=C\C)CC(C)(C)NC(=C)NCCNC |
| InChI | InChI=1S/C14H27N3/c1-7-8-12(2)11-14(4,5)17-13(3)16-10-9-15-6/h7-8,15-17H,2-3,9-11H2,1,4-6H3/b8-7- |
| InChIKey | NSRTXMLHCANTCP-FPLPWBNLSA-N |
| XLogP | 2.16 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|