C20H39N3 — CID 145230157
1-N-[2-(methylamino)ethyl]-1-N'-[(Z)-2-methyl-4-methylidenehept-5-en-2-yl]ethene-1,1-diamine;(E)-3-methylpent-2-ene (PubChem CID 145230157) has the molecular formula C20H39N3 and a molecular weight of 321.55 g/mol. Its IUPAC name is 1-N-[2-(methylamino)ethyl]-1-N'-[(Z)-2-methyl-4-methylidenehept-5-en-2-yl]ethene-1,1-diamine;(E)-3-methylpent-2-ene.
| Compound Name | 1-N-[2-(methylamino)ethyl]-1-N'-[(Z)-2-methyl-4-methylidenehept-5-en-2-yl]ethene-1,1-diamine;(E)-3-methylpent-2-ene |
|---|---|
| PubChem CID | 145230157 |
| Molecular Formula | C20H39N3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.31 |
| IUPAC Name | 1-N-[2-(methylamino)ethyl]-1-N'-[(Z)-2-methyl-4-methylidenehept-5-en-2-yl]ethene-1,1-diamine;(E)-3-methylpent-2-ene |
| SMILES | C/C=C(\C)CC.C=C(/C=C\C)CC(C)(C)NC(=C)NCCNC |
| InChI | InChI=1S/C14H27N3.C6H12/c1-7-8-12(2)11-14(4,5)17-13(3)16-10-9-15-6;1-4-6(3)5-2/h7-8,15-17H,2-3,9-11H2,1,4-6H3;4H,5H2,1-3H3/b8-7-;6-4+ |
| InChIKey | DOODPCHTWJLWGS-UZKVUQFJSA-N |
| XLogP | 4.52 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|