C44H47NO4 — CID 145231293
tert-butyl 4-[2-[4-(2,3-dihydro-1-benzofuran-5-yl)phenyl]-3-oxopropyl]benzoate;N-methyl-4-(2,4,6-trimethylphenyl)aniline (PubChem CID 145231293) has the molecular formula C44H47NO4 and a molecular weight of 653.86 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-(2,3-dihydro-1-benzofuran-5-yl)phenyl]-3-oxopropyl]benzoate;N-methyl-4-(2,4,6-trimethylphenyl)aniline.
| Compound Name | tert-butyl 4-[2-[4-(2,3-dihydro-1-benzofuran-5-yl)phenyl]-3-oxopropyl]benzoate;N-methyl-4-(2,4,6-trimethylphenyl)aniline |
|---|---|
| PubChem CID | 145231293 |
| Molecular Formula | C44H47NO4 |
| Molecular Weight | 653.86 g/mol |
| Exact Mass | 653.35 |
| IUPAC Name | tert-butyl 4-[2-[4-(2,3-dihydro-1-benzofuran-5-yl)phenyl]-3-oxopropyl]benzoate;N-methyl-4-(2,4,6-trimethylphenyl)aniline |
| SMILES | CC(C)(C)OC(=O)c1ccc(CC(C=O)c2ccc(-c3ccc4c(c3)CCO4)cc2)cc1.CNc1ccc(-c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C28H28O4.C16H19N/c1-28(2,3)32-27(30)22-6-4-19(5-7-22)16-25(18-29)21-10-8-20(9-11-21)23-12-13-26-24(17-23)14-15-31-26;1-11-9-12(2)16(13(3)10-11)14-5-7-15(17-4)8-6-14/h4-13,17-18,25H,14-16H2,1-3H3;5-10,17H,1-4H3 |
| InChIKey | JDWVQFMOIKBNNU-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.86 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|