C19H34F2OS — CID 145231416
2,3-difluoro-1-[4-(5-methylhexan-2-yl)cyclohexyl]-4-sulfanyloxycyclohexane (PubChem CID 145231416) has the molecular formula C19H34F2OS and a molecular weight of 348.54 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-(5-methylhexan-2-yl)cyclohexyl]-4-sulfanyloxycyclohexane.
| Compound Name | 2,3-difluoro-1-[4-(5-methylhexan-2-yl)cyclohexyl]-4-sulfanyloxycyclohexane |
|---|---|
| PubChem CID | 145231416 |
| Molecular Formula | C19H34F2OS |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2,3-difluoro-1-[4-(5-methylhexan-2-yl)cyclohexyl]-4-sulfanyloxycyclohexane |
| SMILES | CC(C)CCC(C)C1CCC(C2CCC(OS)C(F)C2F)CC1 |
| InChI | InChI=1S/C19H34F2OS/c1-12(2)4-5-13(3)14-6-8-15(9-7-14)16-10-11-17(22-23)19(21)18(16)20/h12-19,23H,4-11H2,1-3H3 |
| InChIKey | FIPAXGDBVUMZOL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|