C11H20ClN5O — CID 145231645
4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-amine;2-methylpropane (PubChem CID 145231645) has the molecular formula C11H20ClN5O and a molecular weight of 273.77 g/mol. Its IUPAC name is 4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-amine;2-methylpropane.
| Compound Name | 4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-amine;2-methylpropane |
|---|---|
| PubChem CID | 145231645 |
| Molecular Formula | C11H20ClN5O |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-amine;2-methylpropane |
| SMILES | CC(C)C.Nc1nc(Cl)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C7H10ClN5O.C4H10/c8-5-10-6(9)12-7(11-5)13-1-3-14-4-2-13;1-4(2)3/h1-4H2,(H2,9,10,11,12);4H,1-3H3 |
| InChIKey | OXBUDIQDQAHRJA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |