C11H18N6O2 — CID 4577604
4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 4577604) has the molecular formula C11H18N6O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 4577604 |
| Molecular Formula | C11H18N6O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H18N6O2/c12-9-13-10(16-1-5-18-6-2-16)15-11(14-9)17-3-7-19-8-4-17/h1-8H2,(H2,12,13,14,15) |
| InChIKey | AMOTYPIBGOJIMI-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |