C13H22N6O3 — CID 2835546
2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]ethanol (PubChem CID 2835546) has the molecular formula C13H22N6O3 and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]ethanol.
| Compound Name | 2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 2835546 |
| Molecular Formula | C13H22N6O3 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]ethanol |
| SMILES | OCCNc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H22N6O3/c20-6-1-14-11-15-12(18-2-7-21-8-3-18)17-13(16-11)19-4-9-22-10-5-19/h20H,1-10H2,(H,14,15,16,17) |
| InChIKey | GECYRADSXYZERF-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 95.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |