C11H18N6O — CID 66685500
4-(4-piperazin-1-yl-1,3,5-triazin-2-yl)morpholine (PubChem CID 66685500) has the molecular formula C11H18N6O and a molecular weight of 250.31 g/mol. Its IUPAC name is 4-(4-piperazin-1-yl-1,3,5-triazin-2-yl)morpholine.
| Compound Name | 4-(4-piperazin-1-yl-1,3,5-triazin-2-yl)morpholine |
|---|---|
| PubChem CID | 66685500 |
| Molecular Formula | C11H18N6O |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4-(4-piperazin-1-yl-1,3,5-triazin-2-yl)morpholine |
| SMILES | c1nc(N2CCNCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H18N6O/c1-3-16(4-2-12-1)10-13-9-14-11(15-10)17-5-7-18-8-6-17/h9,12H,1-8H2 |
| InChIKey | AVOSVDRFHAWQCC-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |