C12H17N7O2 — CID 714954
(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)cyanamide (PubChem CID 714954) has the molecular formula C12H17N7O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)cyanamide.
| Compound Name | (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)cyanamide |
|---|---|
| PubChem CID | 714954 |
| Molecular Formula | C12H17N7O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)cyanamide |
| SMILES | N#CNc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C12H17N7O2/c13-9-14-10-15-11(18-1-5-20-6-2-18)17-12(16-10)19-3-7-21-8-4-19/h1-8H2,(H,14,15,16,17) |
| InChIKey | INKTYYSRRUYCHZ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|