C27H47F2NO2S — CID 145235137
(3Z,7Z)-3,4-difluoro-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;N-methoxysulfanyl-N-methylmethanamine;propane (PubChem CID 145235137) has the molecular formula C27H47F2NO2S and a molecular weight of 487.74 g/mol. Its IUPAC name is (3Z,7Z)-3,4-difluoro-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;N-methoxysulfanyl-N-methylmethanamine;propane.
| Compound Name | (3Z,7Z)-3,4-difluoro-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;N-methoxysulfanyl-N-methylmethanamine;propane |
|---|---|
| PubChem CID | 145235137 |
| Molecular Formula | C27H47F2NO2S |
| Molecular Weight | 487.74 g/mol |
| Exact Mass | 487.33 |
| IUPAC Name | (3Z,7Z)-3,4-difluoro-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;N-methoxysulfanyl-N-methylmethanamine;propane |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)CC)C(=C)/C(F)=C(\F)C(=C)OC.CCC.COSN(C)C |
| InChI | InChI=1S/C21H30F2O.C3H9NOS.C3H8/c1-9-14(2)10-11-15(3)16(4)12-13-17(5)18(6)20(22)21(23)19(7)24-8;1-4(2)6-5-3;1-3-2/h12-15H,4-7,9-11H2,1-3,8H3;1-3H3;3H2,1-2H3/b13-12-,21-20-;; |
| InChIKey | KCFSZMUCEFSSHG-QYGVOGKKSA-N |
| XLogP | 9.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.74 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|