C28H51NO2S — CID 145235096
N-methoxysulfanyl-N-methylmethanamine;(3Z,7Z)-2-methoxy-4,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;propane (PubChem CID 145235096) has the molecular formula C28H51NO2S and a molecular weight of 465.79 g/mol. Its IUPAC name is N-methoxysulfanyl-N-methylmethanamine;(3Z,7Z)-2-methoxy-4,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;propane.
| Compound Name | N-methoxysulfanyl-N-methylmethanamine;(3Z,7Z)-2-methoxy-4,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;propane |
|---|---|
| PubChem CID | 145235096 |
| Molecular Formula | C28H51NO2S |
| Molecular Weight | 465.79 g/mol |
| Exact Mass | 465.36 |
| IUPAC Name | N-methoxysulfanyl-N-methylmethanamine;(3Z,7Z)-2-methoxy-4,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;propane |
| SMILES | C=C(/C=C(/C)C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)CC)OC.CCC.COSN(C)C |
| InChI | InChI=1S/C22H34O.C3H9NOS.C3H8/c1-10-16(2)11-12-17(3)18(4)13-14-19(5)22(8)20(6)15-21(7)23-9;1-4(2)6-5-3;1-3-2/h13-17H,4-5,7-8,10-12H2,1-3,6,9H3;1-3H3;3H2,1-2H3/b14-13-,20-15-;; |
| InChIKey | WXRAOADMLWFYPP-XQPMHVBGSA-N |
| XLogP | 8.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.79 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|