C29H42O — CID 142282893
(3Z,7Z,11Z)-8-ethyl-2-methoxy-14,17-dimethyl-5,6,9,10,13-pentamethylidenenonadeca-1,3,7,11-tetraene (PubChem CID 142282893) has the molecular formula C29H42O and a molecular weight of 406.65 g/mol. Its IUPAC name is (3Z,7Z,11Z)-8-ethyl-2-methoxy-14,17-dimethyl-5,6,9,10,13-pentamethylidenenonadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11Z)-8-ethyl-2-methoxy-14,17-dimethyl-5,6,9,10,13-pentamethylidenenonadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 142282893 |
| Molecular Formula | C29H42O |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | (3Z,7Z,11Z)-8-ethyl-2-methoxy-14,17-dimethyl-5,6,9,10,13-pentamethylidenenonadeca-1,3,7,11-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C(/CC)C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)CC)OC |
| InChI | InChI=1S/C29H42O/c1-12-21(3)14-15-22(4)23(5)16-17-25(7)28(10)29(13-2)20-26(8)24(6)18-19-27(9)30-11/h16-22H,5-10,12-15H2,1-4,11H3/b17-16-,19-18-,29-20- |
| InChIKey | QSCKJEVOHHXAJA-XNXMYLCTSA-N |
| XLogP | 8.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|