C30H56O — CID 145258423
ethane;(3Z,7Z)-2-methoxy-3,4,10,13-tetramethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;propane (PubChem CID 145258423) has the molecular formula C30H56O and a molecular weight of 432.78 g/mol. Its IUPAC name is ethane;(3Z,7Z)-2-methoxy-3,4,10,13-tetramethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;propane.
| Compound Name | ethane;(3Z,7Z)-2-methoxy-3,4,10,13-tetramethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;propane |
|---|---|
| PubChem CID | 145258423 |
| Molecular Formula | C30H56O |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 432.43 |
| IUPAC Name | ethane;(3Z,7Z)-2-methoxy-3,4,10,13-tetramethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;propane |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)CC)C(=C)/C(C)=C(/C)C(=C)OC.CC.CC.CCC |
| InChI | InChI=1S/C23H36O.C3H8.2C2H6/c1-11-16(2)12-13-17(3)18(4)14-15-19(5)20(6)21(7)22(8)23(9)24-10;1-3-2;2*1-2/h14-17H,4-6,9,11-13H2,1-3,7-8,10H3;3H2,1-2H3;2*1-2H3/b15-14-,22-21-;;; |
| InChIKey | QAVPBZFULCMVFL-KNLQLUKOSA-N |
| XLogP | 10.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|