C25H44O3 — CID 145309459
methoxymethane;(3Z,7Z)-2-methoxy-7,10,13-trimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene (PubChem CID 145309459) has the molecular formula C25H44O3 and a molecular weight of 392.62 g/mol. Its IUPAC name is methoxymethane;(3Z,7Z)-2-methoxy-7,10,13-trimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene.
| Compound Name | methoxymethane;(3Z,7Z)-2-methoxy-7,10,13-trimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene |
|---|---|
| PubChem CID | 145309459 |
| Molecular Formula | C25H44O3 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | methoxymethane;(3Z,7Z)-2-methoxy-7,10,13-trimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(C)=C\C(=C)C(C)CCC(C)C)OC.COC.COC |
| InChI | InChI=1S/C21H32O.2C2H6O/c1-15(2)10-11-16(3)18(5)14-19(6)21(8)17(4)12-13-20(7)22-9;2*1-3-2/h12-16H,4-5,7-8,10-11H2,1-3,6,9H3;2*1-2H3/b13-12-,19-14-;; |
| InChIKey | RYVOWRUBUMXNKC-LBZVSWDGSA-N |
| XLogP | 6.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|