C26H24ClN3O5 — CID 145236794
4-[[3-(chloromethyl)-5-nitrophenyl]methoxy]-5-methoxy-2-[(1-methyl-2,3-dihydroindol-2-yl)methylideneamino]benzaldehyde (PubChem CID 145236794) has the molecular formula C26H24ClN3O5 and a molecular weight of 493.95 g/mol. Its IUPAC name is 4-[[3-(chloromethyl)-5-nitrophenyl]methoxy]-5-methoxy-2-[(1-methyl-2,3-dihydroindol-2-yl)methylideneamino]benzaldehyde.
| Compound Name | 4-[[3-(chloromethyl)-5-nitrophenyl]methoxy]-5-methoxy-2-[(1-methyl-2,3-dihydroindol-2-yl)methylideneamino]benzaldehyde |
|---|---|
| PubChem CID | 145236794 |
| Molecular Formula | C26H24ClN3O5 |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 4-[[3-(chloromethyl)-5-nitrophenyl]methoxy]-5-methoxy-2-[(1-methyl-2,3-dihydroindol-2-yl)methylideneamino]benzaldehyde |
| SMILES | COc1cc(C=O)c(/N=C/C2Cc3ccccc3N2C)cc1OCc1cc(CCl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H24ClN3O5/c1-29-22(10-19-5-3-4-6-24(19)29)14-28-23-12-26(25(34-2)11-20(23)15-31)35-16-18-7-17(13-27)8-21(9-18)30(32)33/h3-9,11-12,14-15,22H,10,13,16H2,1-2H3/b28-14+ |
| InChIKey | BUNBMIBFLWQUCU-CCVNUDIWSA-N |
| XLogP | 5.50 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|