C26H26N2O4 — CID 155174628
N-(2-formyl-4-methoxy-5-phenylmethoxyphenyl)-N-[(1-methyl-2,3-dihydroindol-2-yl)methyl]formamide (PubChem CID 155174628) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-(2-formyl-4-methoxy-5-phenylmethoxyphenyl)-N-[(1-methyl-2,3-dihydroindol-2-yl)methyl]formamide.
| Compound Name | N-(2-formyl-4-methoxy-5-phenylmethoxyphenyl)-N-[(1-methyl-2,3-dihydroindol-2-yl)methyl]formamide |
|---|---|
| PubChem CID | 155174628 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-(2-formyl-4-methoxy-5-phenylmethoxyphenyl)-N-[(1-methyl-2,3-dihydroindol-2-yl)methyl]formamide |
| SMILES | COc1cc(C=O)c(N(C=O)CC2Cc3ccccc3N2C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H26N2O4/c1-27-22(12-20-10-6-7-11-23(20)27)15-28(18-30)24-14-26(25(31-2)13-21(24)16-29)32-17-19-8-4-3-5-9-19/h3-11,13-14,16,18,22H,12,15,17H2,1-2H3 |
| InChIKey | RBAASCUCBMRTDU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|