C35H43N3O5 — CID 155704651
N-[5-(cyclohexa-1,5-dien-1-ylmethoxy)-2-formyl-4-methoxyphenyl]-N-[(1-methyl-2,3-dihydroindol-2-yl)methyl]formamide;ethane;4-methoxyaniline (PubChem CID 155704651) has the molecular formula C35H43N3O5 and a molecular weight of 585.75 g/mol. Its IUPAC name is N-[5-(cyclohexa-1,5-dien-1-ylmethoxy)-2-formyl-4-methoxyphenyl]-N-[(1-methyl-2,3-dihydroindol-2-yl)methyl]formamide;ethane;4-methoxyaniline.
| Compound Name | N-[5-(cyclohexa-1,5-dien-1-ylmethoxy)-2-formyl-4-methoxyphenyl]-N-[(1-methyl-2,3-dihydroindol-2-yl)methyl]formamide;ethane;4-methoxyaniline |
|---|---|
| PubChem CID | 155704651 |
| Molecular Formula | C35H43N3O5 |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.32 |
| IUPAC Name | N-[5-(cyclohexa-1,5-dien-1-ylmethoxy)-2-formyl-4-methoxyphenyl]-N-[(1-methyl-2,3-dihydroindol-2-yl)methyl]formamide;ethane;4-methoxyaniline |
| SMILES | CC.COc1cc(C=O)c(N(C=O)CC2Cc3ccccc3N2C)cc1OCC1=CCCC=C1.COc1ccc(N)cc1 |
| InChI | InChI=1S/C26H28N2O4.C7H9NO.C2H6/c1-27-22(12-20-10-6-7-11-23(20)27)15-28(18-30)24-14-26(25(31-2)13-21(24)16-29)32-17-19-8-4-3-5-9-19;1-9-7-4-2-6(8)3-5-7;1-2/h4,6-11,13-14,16,18,22H,3,5,12,15,17H2,1-2H3;2-5H,8H2,1H3;1-2H3 |
| InChIKey | NPSHVYDHVLZMRS-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|