C17H18N2O3 — CID 145236806
N-(5-hydroxy-4-methoxy-8-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-10-yl)formamide (PubChem CID 145236806) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is N-(5-hydroxy-4-methoxy-8-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-10-yl)formamide.
| Compound Name | N-(5-hydroxy-4-methoxy-8-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-10-yl)formamide |
|---|---|
| PubChem CID | 145236806 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-(5-hydroxy-4-methoxy-8-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-10-yl)formamide |
| SMILES | COc1cc2c(cc1O)NCC(NC=O)Cc1ccccc1-2 |
| InChI | InChI=1S/C17H18N2O3/c1-22-17-7-14-13-5-3-2-4-11(13)6-12(19-10-20)9-18-15(14)8-16(17)21/h2-5,7-8,10,12,18,21H,6,9H2,1H3,(H,19,20) |
| InChIKey | KIFNDVXJNAPYPB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|