C25H23FN4O6S — CID 145237968
6-fluoro-1-methyl-2-methylsulfanyl-7-[4-[(5-nitro-1-benzofuran-2-yl)methyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 145237968) has the molecular formula C25H23FN4O6S and a molecular weight of 526.55 g/mol. Its IUPAC name is 6-fluoro-1-methyl-2-methylsulfanyl-7-[4-[(5-nitro-1-benzofuran-2-yl)methyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 6-fluoro-1-methyl-2-methylsulfanyl-7-[4-[(5-nitro-1-benzofuran-2-yl)methyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 145237968 |
| Molecular Formula | C25H23FN4O6S |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 6-fluoro-1-methyl-2-methylsulfanyl-7-[4-[(5-nitro-1-benzofuran-2-yl)methyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CSc1c(C(=O)O)c(=O)c2cc(F)c(N3CCN(Cc4cc5cc([N+](=O)[O-])ccc5o4)CC3)cc2n1C |
| InChI | InChI=1S/C25H23FN4O6S/c1-27-19-12-20(18(26)11-17(19)23(31)22(25(32)33)24(27)37-2)29-7-5-28(6-8-29)13-16-10-14-9-15(30(34)35)3-4-21(14)36-16/h3-4,9-12H,5-8,13H2,1-2H3,(H,32,33) |
| InChIKey | AIDNLAKZRUJKPC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|